About 2-[1-(2-hydroxy-3,5-dimethylphenyl)-2-methoxyethyl]-4,6-dimethylphenol
2-[1-(2-hydroxy-3,5-dimethylphenyl)-2-methoxyethyl]-4,6-dimethylphenol (PubChem CID 22085903) has the molecular formula C19H24O3
and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[1-(2-hydroxy-3,5-dimethylphenyl)-2-methoxyethyl]-4,6-dimethylphenol.
Molecular Properties
| Compound Name | 2-[1-(2-hydroxy-3,5-dimethylphenyl)-2-methoxyethyl]-4,6-dimethylphenol |
| PubChem CID | 22085903 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 2-[1-(2-hydroxy-3,5-dimethylphenyl)-2-methoxyethyl]-4,6-dimethylphenol |
| SMILES | COCC(c1cc(C)cc(C)c1O)c1cc(C)cc(C)c1O |
| InChI | InChI=1S/C19H24O3/c1-11-6-13(3)18(20)15(8-11)17(10-22-5)16-9-12(2)7-14(4)19(16)21/h6-9,17,20-21H,10H2,1-5H3 |
| InChIKey | GGNJLTFWPDPJGP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-(2-hydroxy-3,5-dimethylphenyl)-2-methoxyethyl]-4,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-hydroxy-3,5-dimethylphenyl)-2-methoxyethyl]-4,6-dimethylphenol?
The IUPAC name of 2-[1-(2-hydroxy-3,5-dimethylphenyl)-2-methoxyethyl]-4,6-dimethylphenol (CID 22085903) is 2-[1-(2-hydroxy-3,5-dimethylphenyl)-2-methoxyethyl]-4,6-dimethylphenol.
What is the SMILES notation for 2-[1-(2-hydroxy-3,5-dimethylphenyl)-2-methoxyethyl]-4,6-dimethylphenol?
The canonical SMILES for 2-[1-(2-hydroxy-3,5-dimethylphenyl)-2-methoxyethyl]-4,6-dimethylphenol is COCC(c1cc(C)cc(C)c1O)c1cc(C)cc(C)c1O.
What is the InChIKey of 2-[1-(2-hydroxy-3,5-dimethylphenyl)-2-methoxyethyl]-4,6-dimethylphenol?
The InChIKey is GGNJLTFWPDPJGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O3/c1-11-6-13(3)18(20)15(8-11)17(10-22-5)16-9-12(2)7-14(4)19(16)21/h6-9,17,20-21H,10H2,1-5H3.
What are the key properties of 2-[1-(2-hydroxy-3,5-dimethylphenyl)-2-methoxyethyl]-4,6-dimethylphenol?
2-[1-(2-hydroxy-3,5-dimethylphenyl)-2-methoxyethyl]-4,6-dimethylphenol has a molecular weight of 300.40 g/mol, XLogP of 4.11, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-hydroxy-3,5-dimethylphenyl)-2-methoxyethyl]-4,6-dimethylphenol is sourced from PubChem (CID 22085903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).