About N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide
N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide (PubChem CID 22086135) has the molecular formula C26H37NO3
and a molecular weight of 411.59 g/mol. Its IUPAC name is N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide.
Molecular Properties
| Compound Name | N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide |
| PubChem CID | 22086135 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide |
| SMILES | CCCCCCCC(=O)NCC(c1cc(C)cc(C)c1O)c1cc(C)cc(C)c1O |
| InChI | InChI=1S/C26H37NO3/c1-6-7-8-9-10-11-24(28)27-16-23(21-14-17(2)12-19(4)25(21)29)22-15-18(3)13-20(5)26(22)30/h12-15,23,29-30H,6-11,16H2,1-5H3,(H,27,28) |
| InChIKey | ZOLJICGNQPJCEP-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide?
The IUPAC name of N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide (CID 22086135) is N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide.
What is the SMILES notation for N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide?
The canonical SMILES for N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide is CCCCCCCC(=O)NCC(c1cc(C)cc(C)c1O)c1cc(C)cc(C)c1O.
What is the InChIKey of N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide?
The InChIKey is ZOLJICGNQPJCEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H37NO3/c1-6-7-8-9-10-11-24(28)27-16-23(21-14-17(2)12-19(4)25(21)29)22-15-18(3)13-20(5)26(22)30/h12-15,23,29-30H,6-11,16H2,1-5H3,(H,27,28).
What are the key properties of N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide?
N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide has a molecular weight of 411.59 g/mol, XLogP of 5.94, 10 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide is sourced from PubChem (CID 22086135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).