C26H37NO3 — CID 22086135
N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide (PubChem CID 22086135) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide.
| Compound Name | N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide |
|---|---|
| PubChem CID | 22086135 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | N-[2,2-bis(2-hydroxy-3,5-dimethylphenyl)ethyl]octanamide |
| SMILES | CCCCCCCC(=O)NCC(c1cc(C)cc(C)c1O)c1cc(C)cc(C)c1O |
| InChI | InChI=1S/C26H37NO3/c1-6-7-8-9-10-11-24(28)27-16-23(21-14-17(2)12-19(4)25(21)29)22-15-18(3)13-20(5)26(22)30/h12-15,23,29-30H,6-11,16H2,1-5H3,(H,27,28) |
| InChIKey | ZOLJICGNQPJCEP-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|