About 2-chloro-6-ethyl-3,4,5-trimethyloxane
2-chloro-6-ethyl-3,4,5-trimethyloxane (PubChem CID 22086236) has the molecular formula C10H19ClO
and a molecular weight of 190.71 g/mol. Its IUPAC name is 2-chloro-6-ethyl-3,4,5-trimethyloxane.
Molecular Properties
| Compound Name | 2-chloro-6-ethyl-3,4,5-trimethyloxane |
| PubChem CID | 22086236 |
| Molecular Formula | C10H19ClO |
| Molecular Weight | 190.71 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-chloro-6-ethyl-3,4,5-trimethyloxane |
| SMILES | CCC1OC(Cl)C(C)C(C)C1C |
| InChI | InChI=1S/C10H19ClO/c1-5-9-7(3)6(2)8(4)10(11)12-9/h6-10H,5H2,1-4H3 |
| InChIKey | WDHMMPABNIBGAX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.71 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-ethyl-3,4,5-trimethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-ethyl-3,4,5-trimethyloxane?
The IUPAC name of 2-chloro-6-ethyl-3,4,5-trimethyloxane (CID 22086236) is 2-chloro-6-ethyl-3,4,5-trimethyloxane.
What is the SMILES notation for 2-chloro-6-ethyl-3,4,5-trimethyloxane?
The canonical SMILES for 2-chloro-6-ethyl-3,4,5-trimethyloxane is CCC1OC(Cl)C(C)C(C)C1C.
What is the InChIKey of 2-chloro-6-ethyl-3,4,5-trimethyloxane?
The InChIKey is WDHMMPABNIBGAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19ClO/c1-5-9-7(3)6(2)8(4)10(11)12-9/h6-10H,5H2,1-4H3.
What are the key properties of 2-chloro-6-ethyl-3,4,5-trimethyloxane?
2-chloro-6-ethyl-3,4,5-trimethyloxane has a molecular weight of 190.71 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-ethyl-3,4,5-trimethyloxane is sourced from PubChem (CID 22086236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).