About 2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]oxybenzoic acid
2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]oxybenzoic acid (PubChem CID 22086622) has the molecular formula C16H14N4O6
and a molecular weight of 358.31 g/mol. Its IUPAC name is 2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]oxybenzoic acid.
Molecular Properties
| Compound Name | 2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]oxybenzoic acid |
| PubChem CID | 22086622 |
| Molecular Formula | C16H14N4O6 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]oxybenzoic acid |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)Oc2ccccc2C(=O)O)n(C)c1=O |
| InChI | InChI=1S/C16H14N4O6/c1-18-13-12(14(22)19(2)16(18)25)20(8-17-13)7-11(21)26-10-6-4-3-5-9(10)15(23)24/h3-6,8H,7H2,1-2H3,(H,23,24) |
| InChIKey | RSNOXVZUCUBUKF-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]oxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]oxybenzoic acid?
The IUPAC name of 2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]oxybenzoic acid (CID 22086622) is 2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]oxybenzoic acid.
What is the SMILES notation for 2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]oxybenzoic acid?
The canonical SMILES for 2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]oxybenzoic acid is Cn1c(=O)c2c(ncn2CC(=O)Oc2ccccc2C(=O)O)n(C)c1=O.
What is the InChIKey of 2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]oxybenzoic acid?
The InChIKey is RSNOXVZUCUBUKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N4O6/c1-18-13-12(14(22)19(2)16(18)25)20(8-17-13)7-11(21)26-10-6-4-3-5-9(10)15(23)24/h3-6,8H,7H2,1-2H3,(H,23,24).
What are the key properties of 2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]oxybenzoic acid?
2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]oxybenzoic acid has a molecular weight of 358.31 g/mol, XLogP of -0.26, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]oxybenzoic acid is sourced from PubChem (CID 22086622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).