C18H20N6O3 — CID 22086713
8-[2-(5-hydroxy-1H-indol-3-yl)ethylamino]-1,3,7-trimethylpurine-2,6-dione (PubChem CID 22086713) has the molecular formula C18H20N6O3 and a molecular weight of 368.40 g/mol. Its IUPAC name is 8-[2-(5-hydroxy-1H-indol-3-yl)ethylamino]-1,3,7-trimethylpurine-2,6-dione.
| Compound Name | 8-[2-(5-hydroxy-1H-indol-3-yl)ethylamino]-1,3,7-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 22086713 |
| Molecular Formula | C18H20N6O3 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 8-[2-(5-hydroxy-1H-indol-3-yl)ethylamino]-1,3,7-trimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NCCc3c[nH]c4ccc(O)cc34)n2C)n(C)c1=O |
| InChI | InChI=1S/C18H20N6O3/c1-22-14-15(23(2)18(27)24(3)16(14)26)21-17(22)19-7-6-10-9-20-13-5-4-11(25)8-12(10)13/h4-5,8-9,20,25H,6-7H2,1-3H3,(H,19,21) |
| InChIKey | BQISACOZZVOFGJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 109.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |