About (E)-N,3,4-trimethyl-N-propan-2-ylpent-2-en-2-amine
(E)-N,3,4-trimethyl-N-propan-2-ylpent-2-en-2-amine (PubChem CID 22086825) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is (E)-N,3,4-trimethyl-N-propan-2-ylpent-2-en-2-amine.
Molecular Properties
| Compound Name | (E)-N,3,4-trimethyl-N-propan-2-ylpent-2-en-2-amine |
| PubChem CID | 22086825 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | (E)-N,3,4-trimethyl-N-propan-2-ylpent-2-en-2-amine |
| SMILES | C/C(=C(/C)N(C)C(C)C)C(C)C |
| InChI | InChI=1S/C11H23N/c1-8(2)10(5)11(6)12(7)9(3)4/h8-9H,1-7H3/b11-10+ |
| InChIKey | HCIASQUONBKOPY-ZHACJKMWSA-N |
| XLogP | 3.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-N,3,4-trimethyl-N-propan-2-ylpent-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,3,4-trimethyl-N-propan-2-ylpent-2-en-2-amine?
The IUPAC name of (E)-N,3,4-trimethyl-N-propan-2-ylpent-2-en-2-amine (CID 22086825) is (E)-N,3,4-trimethyl-N-propan-2-ylpent-2-en-2-amine.
What is the SMILES notation for (E)-N,3,4-trimethyl-N-propan-2-ylpent-2-en-2-amine?
The canonical SMILES for (E)-N,3,4-trimethyl-N-propan-2-ylpent-2-en-2-amine is C/C(=C(/C)N(C)C(C)C)C(C)C.
What is the InChIKey of (E)-N,3,4-trimethyl-N-propan-2-ylpent-2-en-2-amine?
The InChIKey is HCIASQUONBKOPY-ZHACJKMWSA-N. The full InChI is InChI=1S/C11H23N/c1-8(2)10(5)11(6)12(7)9(3)4/h8-9H,1-7H3/b11-10+.
What are the key properties of (E)-N,3,4-trimethyl-N-propan-2-ylpent-2-en-2-amine?
(E)-N,3,4-trimethyl-N-propan-2-ylpent-2-en-2-amine has a molecular weight of 169.31 g/mol, XLogP of 3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,3,4-trimethyl-N-propan-2-ylpent-2-en-2-amine is sourced from PubChem (CID 22086825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).