C24H19F2NO3 — CID 22087383
[4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]phenyl] propanoate (PubChem CID 22087383) has the molecular formula C24H19F2NO3 and a molecular weight of 407.42 g/mol. Its IUPAC name is [4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]phenyl] propanoate.
| Compound Name | [4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]phenyl] propanoate |
|---|---|
| PubChem CID | 22087383 |
| Molecular Formula | C24H19F2NO3 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(-c2ccc(C3COC(c4c(F)cccc4F)=N3)cc2)cc1 |
| InChI | InChI=1S/C24H19F2NO3/c1-2-22(28)30-18-12-10-16(11-13-18)15-6-8-17(9-7-15)21-14-29-24(27-21)23-19(25)4-3-5-20(23)26/h3-13,21H,2,14H2,1H3 |
| InChIKey | RVSLSETWRAGFLE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|