C21H21NO4S — CID 22087416
[2,4-bis(phenylmethoxy)phenyl]methanesulfonamide (PubChem CID 22087416) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is [2,4-bis(phenylmethoxy)phenyl]methanesulfonamide.
| Compound Name | [2,4-bis(phenylmethoxy)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 22087416 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | [2,4-bis(phenylmethoxy)phenyl]methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1ccc(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C21H21NO4S/c22-27(23,24)16-19-11-12-20(25-14-17-7-3-1-4-8-17)13-21(19)26-15-18-9-5-2-6-10-18/h1-13H,14-16H2,(H2,22,23,24) |
| InChIKey | HHGPNDIQVSLJQO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |