C16H17F3N2O4S — CID 22087460
N-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]-2-hydroxyphenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 22087460) has the molecular formula C16H17F3N2O4S and a molecular weight of 390.38 g/mol. Its IUPAC name is N-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]-2-hydroxyphenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]-2-hydroxyphenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 22087460 |
| Molecular Formula | C16H17F3N2O4S |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | N-[4-[2-(5-ethyl-2-pyridinyl)ethoxy]-2-hydroxyphenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCc1ccc(CCOc2ccc(NS(=O)(=O)C(F)(F)F)c(O)c2)nc1 |
| InChI | InChI=1S/C16H17F3N2O4S/c1-2-11-3-4-12(20-10-11)7-8-25-13-5-6-14(15(22)9-13)21-26(23,24)16(17,18)19/h3-6,9-10,21-22H,2,7-8H2,1H3 |
| InChIKey | JTIZKGWBNZGDFE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|