About 3-[4-[4-(1,5-dimethylpyrazol-3-yl)phenoxy]phenyl]-1,5-dimethylpyrazole
3-[4-[4-(1,5-dimethylpyrazol-3-yl)phenoxy]phenyl]-1,5-dimethylpyrazole (PubChem CID 22088070) has the molecular formula C22H22N4O
and a molecular weight of 358.45 g/mol. Its IUPAC name is 3-[4-[4-(1,5-dimethylpyrazol-3-yl)phenoxy]phenyl]-1,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 3-[4-[4-(1,5-dimethylpyrazol-3-yl)phenoxy]phenyl]-1,5-dimethylpyrazole |
| PubChem CID | 22088070 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 3-[4-[4-(1,5-dimethylpyrazol-3-yl)phenoxy]phenyl]-1,5-dimethylpyrazole |
| SMILES | Cc1cc(-c2ccc(Oc3ccc(-c4cc(C)n(C)n4)cc3)cc2)nn1C |
| InChI | InChI=1S/C22H22N4O/c1-15-13-21(23-25(15)3)17-5-9-19(10-6-17)27-20-11-7-18(8-12-20)22-14-16(2)26(4)24-22/h5-14H,1-4H3 |
| InChIKey | YENOYUUEHMLHEJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-[4-(1,5-dimethylpyrazol-3-yl)phenoxy]phenyl]-1,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[4-(1,5-dimethylpyrazol-3-yl)phenoxy]phenyl]-1,5-dimethylpyrazole?
The IUPAC name of 3-[4-[4-(1,5-dimethylpyrazol-3-yl)phenoxy]phenyl]-1,5-dimethylpyrazole (CID 22088070) is 3-[4-[4-(1,5-dimethylpyrazol-3-yl)phenoxy]phenyl]-1,5-dimethylpyrazole.
What is the SMILES notation for 3-[4-[4-(1,5-dimethylpyrazol-3-yl)phenoxy]phenyl]-1,5-dimethylpyrazole?
The canonical SMILES for 3-[4-[4-(1,5-dimethylpyrazol-3-yl)phenoxy]phenyl]-1,5-dimethylpyrazole is Cc1cc(-c2ccc(Oc3ccc(-c4cc(C)n(C)n4)cc3)cc2)nn1C.
What is the InChIKey of 3-[4-[4-(1,5-dimethylpyrazol-3-yl)phenoxy]phenyl]-1,5-dimethylpyrazole?
The InChIKey is YENOYUUEHMLHEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O/c1-15-13-21(23-25(15)3)17-5-9-19(10-6-17)27-20-11-7-18(8-12-20)22-14-16(2)26(4)24-22/h5-14H,1-4H3.
What are the key properties of 3-[4-[4-(1,5-dimethylpyrazol-3-yl)phenoxy]phenyl]-1,5-dimethylpyrazole?
3-[4-[4-(1,5-dimethylpyrazol-3-yl)phenoxy]phenyl]-1,5-dimethylpyrazole has a molecular weight of 358.45 g/mol, XLogP of 4.90, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[4-(1,5-dimethylpyrazol-3-yl)phenoxy]phenyl]-1,5-dimethylpyrazole is sourced from PubChem (CID 22088070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).