C17H28N6O2 — CID 22088620
2-[4-[(3S,5R)-4-carbamimidoyl-3,5-dimethylpiperazin-1-yl]pyrimidin-2-yl]ethyl butanoate (PubChem CID 22088620) has the molecular formula C17H28N6O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[4-[(3S,5R)-4-carbamimidoyl-3,5-dimethylpiperazin-1-yl]pyrimidin-2-yl]ethyl butanoate.
| Compound Name | 2-[4-[(3S,5R)-4-carbamimidoyl-3,5-dimethylpiperazin-1-yl]pyrimidin-2-yl]ethyl butanoate |
|---|---|
| PubChem CID | 22088620 |
| Molecular Formula | C17H28N6O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2-[4-[(3S,5R)-4-carbamimidoyl-3,5-dimethylpiperazin-1-yl]pyrimidin-2-yl]ethyl butanoate |
| SMILES | [H]/N=C(\N)N1[C@H](C)CN(c2ccnc(CCOC(=O)CCC)n2)C[C@@H]1C |
| InChI | InChI=1S/C17H28N6O2/c1-4-5-16(24)25-9-7-14-20-8-6-15(21-14)22-10-12(2)23(17(18)19)13(3)11-22/h6,8,12-13H,4-5,7,9-11H2,1-3H3,(H3,18,19)/t12-,13+ |
| InChIKey | ZHMJQELZPKORPL-BETUJISGSA-N |
| XLogP | 1.15 |
| TPSA | 108.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|