About 3-methyl-1-propyl-1H-imidazole-1,3-diium
3-methyl-1-propyl-1H-imidazole-1,3-diium (PubChem CID 22088709) has the molecular formula C7H14N2+2
and a molecular weight of 126.20 g/mol. Its IUPAC name is 3-methyl-1-propyl-1H-imidazole-1,3-diium.
Molecular Properties
| Compound Name | 3-methyl-1-propyl-1H-imidazole-1,3-diium |
| PubChem CID | 22088709 |
| Molecular Formula | C7H14N2+2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.11 |
| IUPAC Name | 3-methyl-1-propyl-1H-imidazole-1,3-diium |
| SMILES | CCC[NH+]1C=C[N+](C)=C1 |
| InChI | InChI=1S/C7H13N2/c1-3-4-9-6-5-8(2)7-9/h5-7H,3-4H2,1-2H3/q+1/p+1 |
| InChIKey | WVDDUSFOSWWJJH-UHFFFAOYSA-O |
| XLogP | -0.56 |
| TPSA | 7.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1-propyl-1H-imidazole-1,3-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-propyl-1H-imidazole-1,3-diium?
The IUPAC name of 3-methyl-1-propyl-1H-imidazole-1,3-diium (CID 22088709) is 3-methyl-1-propyl-1H-imidazole-1,3-diium.
What is the SMILES notation for 3-methyl-1-propyl-1H-imidazole-1,3-diium?
The canonical SMILES for 3-methyl-1-propyl-1H-imidazole-1,3-diium is CCC[NH+]1C=C[N+](C)=C1.
What is the InChIKey of 3-methyl-1-propyl-1H-imidazole-1,3-diium?
The InChIKey is WVDDUSFOSWWJJH-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H13N2/c1-3-4-9-6-5-8(2)7-9/h5-7H,3-4H2,1-2H3/q+1/p+1.
What are the key properties of 3-methyl-1-propyl-1H-imidazole-1,3-diium?
3-methyl-1-propyl-1H-imidazole-1,3-diium has a molecular weight of 126.20 g/mol, XLogP of -0.56, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-propyl-1H-imidazole-1,3-diium is sourced from PubChem (CID 22088709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).