About CID 22088796
CID 22088796 (PubChem CID 22088796) has the molecular formula C2H6BOSi
and a molecular weight of 84.97 g/mol.
Molecular Properties
| Compound Name | CID 22088796 |
| PubChem CID | 22088796 |
| Molecular Formula | C2H6BOSi |
| Molecular Weight | 84.97 g/mol |
| Exact Mass | 85.03 |
| IUPAC Name | — |
| SMILES | [B][Si](C)OC |
| InChI | InChI=1S/C2H6BOSi/c1-4-5(2)3/h1-2H3 |
| InChIKey | WEIBQVUPFWBLRZ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 84.97 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22088796 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22088796?
The IUPAC name of CID 22088796 (CID 22088796) is not available.
What is the SMILES notation for CID 22088796?
The canonical SMILES for CID 22088796 is [B][Si](C)OC.
What is the InChIKey of CID 22088796?
The InChIKey is WEIBQVUPFWBLRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6BOSi/c1-4-5(2)3/h1-2H3.
What are the key properties of CID 22088796?
CID 22088796 has a molecular weight of 84.97 g/mol, XLogP of -0.08, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22088796 is sourced from PubChem (CID 22088796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).