C9H8F12O — CID 22088870
1-ethoxy-1,1,2,2,3,4,4,5,5-nonafluoro-3-(trifluoromethyl)hexane (PubChem CID 22088870) has the molecular formula C9H8F12O and a molecular weight of 360.14 g/mol. Its IUPAC name is 1-ethoxy-1,1,2,2,3,4,4,5,5-nonafluoro-3-(trifluoromethyl)hexane.
| Compound Name | 1-ethoxy-1,1,2,2,3,4,4,5,5-nonafluoro-3-(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 22088870 |
| Molecular Formula | C9H8F12O |
| Molecular Weight | 360.14 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 1-ethoxy-1,1,2,2,3,4,4,5,5-nonafluoro-3-(trifluoromethyl)hexane |
| SMILES | CCOC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C9H8F12O/c1-3-22-9(20,21)7(15,16)5(12,8(17,18)19)6(13,14)4(2,10)11/h3H2,1-2H3 |
| InChIKey | YOKYNMBPRBZRIX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.14 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|