C18H6F4O6 — CID 22088873
5-[1-(1,3-dioxo-2-benzofuran-5-yl)-1,2,2,2-tetrafluoroethyl]-2-benzofuran-1,3-dione (PubChem CID 22088873) has the molecular formula C18H6F4O6 and a molecular weight of 394.23 g/mol. Its IUPAC name is 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-1,2,2,2-tetrafluoroethyl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-1,2,2,2-tetrafluoroethyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 22088873 |
| Molecular Formula | C18H6F4O6 |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-1,2,2,2-tetrafluoroethyl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(C(F)(c3ccc4c(c3)C(=O)OC4=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C18H6F4O6/c19-17(18(20,21)22,7-1-3-9-11(5-7)15(25)27-13(9)23)8-2-4-10-12(6-8)16(26)28-14(10)24/h1-6H |
| InChIKey | SECWVBOMSIGQIS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|