C33H35BN2O6 — CID 22088963
CID 22088963 (PubChem CID 22088963) has the molecular formula C33H35BN2O6 and a molecular weight of 566.46 g/mol.
| Compound Name | CID 22088963 |
|---|---|
| PubChem CID | 22088963 |
| Molecular Formula | C33H35BN2O6 |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1C(Cc2ccccc2)C(C(O)C(Cc2ccccc2)C(=O)N2C(=O)OC(c3ccccc3)C2C)OC1(C)C |
| InChI | InChI=1S/C33H35BN2O6/c1-21-28(24-17-11-6-12-18-24)41-32(40)35(21)30(38)25(19-22-13-7-4-8-14-22)27(37)29-26(20-23-15-9-5-10-16-23)36(31(34)39)33(2,3)42-29/h4-18,21,25-29,37H,19-20H2,1-3H3 |
| InChIKey | OCBKEOQONIZPQI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|