C26H40N2O6 — CID 22088967
3,4-bis(2-methoxyethoxymethoxy)-1,6-diphenylhexane-2,5-diamine (PubChem CID 22088967) has the molecular formula C26H40N2O6 and a molecular weight of 476.61 g/mol. Its IUPAC name is 3,4-bis(2-methoxyethoxymethoxy)-1,6-diphenylhexane-2,5-diamine.
| Compound Name | 3,4-bis(2-methoxyethoxymethoxy)-1,6-diphenylhexane-2,5-diamine |
|---|---|
| PubChem CID | 22088967 |
| Molecular Formula | C26H40N2O6 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 3,4-bis(2-methoxyethoxymethoxy)-1,6-diphenylhexane-2,5-diamine |
| SMILES | COCCOCOC(C(N)Cc1ccccc1)C(OCOCCOC)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C26H40N2O6/c1-29-13-15-31-19-33-25(23(27)17-21-9-5-3-6-10-21)26(34-20-32-16-14-30-2)24(28)18-22-11-7-4-8-12-22/h3-12,23-26H,13-20,27-28H2,1-2H3 |
| InChIKey | XFLASAGWGFREET-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|