About 4,7-dibenzyl-5-(hydroxymethyl)-6-methoxy-1,3-diazepan-2-one
4,7-dibenzyl-5-(hydroxymethyl)-6-methoxy-1,3-diazepan-2-one (PubChem CID 22088999) has the molecular formula C21H26N2O3
and a molecular weight of 354.45 g/mol. Its IUPAC name is 4,7-dibenzyl-5-(hydroxymethyl)-6-methoxy-1,3-diazepan-2-one.
Molecular Properties
| Compound Name | 4,7-dibenzyl-5-(hydroxymethyl)-6-methoxy-1,3-diazepan-2-one |
| PubChem CID | 22088999 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 4,7-dibenzyl-5-(hydroxymethyl)-6-methoxy-1,3-diazepan-2-one |
| SMILES | COC1C(Cc2ccccc2)NC(=O)NC(Cc2ccccc2)C1CO |
| InChI | InChI=1S/C21H26N2O3/c1-26-20-17(14-24)18(12-15-8-4-2-5-9-15)22-21(25)23-19(20)13-16-10-6-3-7-11-16/h2-11,17-20,24H,12-14H2,1H3,(H2,22,23,25) |
| InChIKey | NGPFUCZEABMJNE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,7-dibenzyl-5-(hydroxymethyl)-6-methoxy-1,3-diazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dibenzyl-5-(hydroxymethyl)-6-methoxy-1,3-diazepan-2-one?
The IUPAC name of 4,7-dibenzyl-5-(hydroxymethyl)-6-methoxy-1,3-diazepan-2-one (CID 22088999) is 4,7-dibenzyl-5-(hydroxymethyl)-6-methoxy-1,3-diazepan-2-one.
What is the SMILES notation for 4,7-dibenzyl-5-(hydroxymethyl)-6-methoxy-1,3-diazepan-2-one?
The canonical SMILES for 4,7-dibenzyl-5-(hydroxymethyl)-6-methoxy-1,3-diazepan-2-one is COC1C(Cc2ccccc2)NC(=O)NC(Cc2ccccc2)C1CO.
What is the InChIKey of 4,7-dibenzyl-5-(hydroxymethyl)-6-methoxy-1,3-diazepan-2-one?
The InChIKey is NGPFUCZEABMJNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O3/c1-26-20-17(14-24)18(12-15-8-4-2-5-9-15)22-21(25)23-19(20)13-16-10-6-3-7-11-16/h2-11,17-20,24H,12-14H2,1H3,(H2,22,23,25).
What are the key properties of 4,7-dibenzyl-5-(hydroxymethyl)-6-methoxy-1,3-diazepan-2-one?
4,7-dibenzyl-5-(hydroxymethyl)-6-methoxy-1,3-diazepan-2-one has a molecular weight of 354.45 g/mol, XLogP of 2.15, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dibenzyl-5-(hydroxymethyl)-6-methoxy-1,3-diazepan-2-one is sourced from PubChem (CID 22088999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).