C13H23N2O3+ — CID 22089041
1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-yl)pyrrolidine-2,5-dione (PubChem CID 22089041) has the molecular formula C13H23N2O3+ and a molecular weight of 255.34 g/mol. Its IUPAC name is 1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 22089041 |
| Molecular Formula | C13H23N2O3+ |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 1-(1-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-yl)pyrrolidine-2,5-dione |
| SMILES | CC1(C)CC(N2C(=O)CCC2=O)CC(C)(C)[NH+]1O |
| InChI | InChI=1S/C13H22N2O3/c1-12(2)7-9(8-13(3,4)15(12)18)14-10(16)5-6-11(14)17/h9,18H,5-8H2,1-4H3/p+1 |
| InChIKey | ZHMZILPINCAHPK-UHFFFAOYSA-O |
| XLogP | 0.13 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|