C13H27NO2 — CID 22089052
4-butoxy-1-hydroxy-2,2,6,6-tetramethylpiperidine (PubChem CID 22089052) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 4-butoxy-1-hydroxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-butoxy-1-hydroxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 22089052 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 4-butoxy-1-hydroxy-2,2,6,6-tetramethylpiperidine |
| SMILES | CCCCOC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C13H27NO2/c1-6-7-8-16-11-9-12(2,3)14(15)13(4,5)10-11/h11,15H,6-10H2,1-5H3 |
| InChIKey | OJNXTMASBDMLPH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|