C31H34F3N3O5 — CID 22089102
2-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanoylamino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (PubChem CID 22089102) has the molecular formula C31H34F3N3O5 and a molecular weight of 585.62 g/mol. Its IUPAC name is 2-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanoylamino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid.
| Compound Name | 2-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanoylamino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 22089102 |
| Molecular Formula | C31H34F3N3O5 |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | 2-[6-[(4,6-diphenyl-2-pyridinyl)oxy]hexanoylamino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| SMILES | O=C(CCCCCOc1cc(-c2ccccc2)cc(-c2ccccc2)n1)NC(CCCCNC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C31H34F3N3O5/c32-31(33,34)30(41)35-18-10-9-16-25(29(39)40)36-27(38)17-8-3-11-19-42-28-21-24(22-12-4-1-5-13-22)20-26(37-28)23-14-6-2-7-15-23/h1-2,4-7,12-15,20-21,25H,3,8-11,16-19H2,(H,35,41)(H,36,38)(H,39,40) |
| InChIKey | MMWXZRHTOCKOLO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|