C48H40N4O7 — CID 22089898
[4-[N-(4-ethoxyphenyl)-4-[5-[4-(4-ethoxy-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl]-1,3,4-oxadiazol-2-yl]anilino]phenyl] prop-2-enoate (PubChem CID 22089898) has the molecular formula C48H40N4O7 and a molecular weight of 784.87 g/mol. Its IUPAC name is [4-[N-(4-ethoxyphenyl)-4-[5-[4-(4-ethoxy-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl]-1,3,4-oxadiazol-2-yl]anilino]phenyl] prop-2-enoate.
| Compound Name | [4-[N-(4-ethoxyphenyl)-4-[5-[4-(4-ethoxy-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl]-1,3,4-oxadiazol-2-yl]anilino]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 22089898 |
| Molecular Formula | C48H40N4O7 |
| Molecular Weight | 784.87 g/mol |
| Exact Mass | 784.29 |
| IUPAC Name | [4-[N-(4-ethoxyphenyl)-4-[5-[4-(4-ethoxy-N-(4-prop-2-enoyloxyphenyl)anilino)phenyl]-1,3,4-oxadiazol-2-yl]anilino]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(N(c2ccc(OCC)cc2)c2ccc(-c3nnc(-c4ccc(N(c5ccc(OCC)cc5)c5ccc(OC(=O)C=C)cc5)cc4)o3)cc2)cc1 |
| InChI | InChI=1S/C48H40N4O7/c1-5-45(53)57-43-29-21-39(22-30-43)51(37-17-25-41(26-18-37)55-7-3)35-13-9-33(10-14-35)47-49-50-48(59-47)34-11-15-36(16-12-34)52(38-19-27-42(28-20-38)56-8-4)40-23-31-44(32-24-40)58-46(54)6-2/h5-6,9-32H,1-2,7-8H2,3-4H3 |
| InChIKey | ATKMUUYPVQPPOQ-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 116.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.87 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|