About methyl 4-(2,5-dioxohexan-3-ylamino)-4-oxobutanoate
methyl 4-(2,5-dioxohexan-3-ylamino)-4-oxobutanoate (PubChem CID 22090377) has the molecular formula C11H17NO5
and a molecular weight of 243.26 g/mol. Its IUPAC name is methyl 4-(2,5-dioxohexan-3-ylamino)-4-oxobutanoate.
Molecular Properties
| Compound Name | methyl 4-(2,5-dioxohexan-3-ylamino)-4-oxobutanoate |
| PubChem CID | 22090377 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | methyl 4-(2,5-dioxohexan-3-ylamino)-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)NC(CC(C)=O)C(C)=O |
| InChI | InChI=1S/C11H17NO5/c1-7(13)6-9(8(2)14)12-10(15)4-5-11(16)17-3/h9H,4-6H2,1-3H3,(H,12,15) |
| InChIKey | JBOGVBKKYNKVNG-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-(2,5-dioxohexan-3-ylamino)-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2,5-dioxohexan-3-ylamino)-4-oxobutanoate?
The IUPAC name of methyl 4-(2,5-dioxohexan-3-ylamino)-4-oxobutanoate (CID 22090377) is methyl 4-(2,5-dioxohexan-3-ylamino)-4-oxobutanoate.
What is the SMILES notation for methyl 4-(2,5-dioxohexan-3-ylamino)-4-oxobutanoate?
The canonical SMILES for methyl 4-(2,5-dioxohexan-3-ylamino)-4-oxobutanoate is COC(=O)CCC(=O)NC(CC(C)=O)C(C)=O.
What is the InChIKey of methyl 4-(2,5-dioxohexan-3-ylamino)-4-oxobutanoate?
The InChIKey is JBOGVBKKYNKVNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO5/c1-7(13)6-9(8(2)14)12-10(15)4-5-11(16)17-3/h9H,4-6H2,1-3H3,(H,12,15).
What are the key properties of methyl 4-(2,5-dioxohexan-3-ylamino)-4-oxobutanoate?
methyl 4-(2,5-dioxohexan-3-ylamino)-4-oxobutanoate has a molecular weight of 243.26 g/mol, XLogP of -0.01, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2,5-dioxohexan-3-ylamino)-4-oxobutanoate is sourced from PubChem (CID 22090377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).