About thieno[3,2-b]pyridin-3-ol
thieno[3,2-b]pyridin-3-ol (PubChem CID 22090624) has the molecular formula C7H5NOS
and a molecular weight of 151.19 g/mol. Its IUPAC name is thieno[3,2-b]pyridin-3-ol.
Molecular Properties
| Compound Name | thieno[3,2-b]pyridin-3-ol |
| PubChem CID | 22090624 |
| Molecular Formula | C7H5NOS |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.01 |
| IUPAC Name | thieno[3,2-b]pyridin-3-ol |
| SMILES | Oc1csc2cccnc12 |
| InChI | InChI=1S/C7H5NOS/c9-5-4-10-6-2-1-3-8-7(5)6/h1-4,9H |
| InChIKey | IODFIIZCMGDULB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|
Analyze thieno[3,2-b]pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-b]pyridin-3-ol?
The IUPAC name of thieno[3,2-b]pyridin-3-ol (CID 22090624) is thieno[3,2-b]pyridin-3-ol.
What is the SMILES notation for thieno[3,2-b]pyridin-3-ol?
The canonical SMILES for thieno[3,2-b]pyridin-3-ol is Oc1csc2cccnc12.
What is the InChIKey of thieno[3,2-b]pyridin-3-ol?
The InChIKey is IODFIIZCMGDULB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NOS/c9-5-4-10-6-2-1-3-8-7(5)6/h1-4,9H.
What are the key properties of thieno[3,2-b]pyridin-3-ol?
thieno[3,2-b]pyridin-3-ol has a molecular weight of 151.19 g/mol, XLogP of 2.00, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-b]pyridin-3-ol is sourced from PubChem (CID 22090624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).