C11H21O4PW — CID 22090803
carbanide;6-(methoxymethyl)-3-methyl-4-methylphosphanyloxy-2,3,4,5-tetrahydropyran-2-ide-6-carbaldehyde;tungsten(2+) (PubChem CID 22090803) has the molecular formula C11H21O4PW and a molecular weight of 432.10 g/mol. Its IUPAC name is carbanide;6-(methoxymethyl)-3-methyl-4-methylphosphanyloxy-2,3,4,5-tetrahydropyran-2-ide-6-carbaldehyde;tungsten(2+).
| Compound Name | carbanide;6-(methoxymethyl)-3-methyl-4-methylphosphanyloxy-2,3,4,5-tetrahydropyran-2-ide-6-carbaldehyde;tungsten(2+) |
|---|---|
| PubChem CID | 22090803 |
| Molecular Formula | C11H21O4PW |
| Molecular Weight | 432.10 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | carbanide;6-(methoxymethyl)-3-methyl-4-methylphosphanyloxy-2,3,4,5-tetrahydropyran-2-ide-6-carbaldehyde;tungsten(2+) |
| SMILES | COCC1(C=O)CC(OPC)C(C)[CH-]O1.[CH3-].[W+2] |
| InChI | InChI=1S/C10H18O4P.CH3.W/c1-8-5-13-10(6-11,7-12-2)4-9(8)14-15-3;;/h5-6,8-9,15H,4,7H2,1-3H3;1H3;/q2*-1;+2 |
| InChIKey | MMPKLZSJSDZVGS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.10 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|