About actinium;butane-1,1,4-triol
actinium;butane-1,1,4-triol (PubChem CID 22090838) has the molecular formula C4H10AcO3
and a molecular weight of 333.12 g/mol. Its IUPAC name is actinium;butane-1,1,4-triol.
Molecular Properties
| Compound Name | actinium;butane-1,1,4-triol |
| PubChem CID | 22090838 |
| Molecular Formula | C4H10AcO3 |
| Molecular Weight | 333.12 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | actinium;butane-1,1,4-triol |
| SMILES | OCCCC(O)O.[Ac] |
| InChI | InChI=1S/C4H10O3.Ac/c5-3-1-2-4(6)7;/h4-7H,1-3H2; |
| InChIKey | QPPZTRPEBZIAGG-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.12 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze actinium;butane-1,1,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;butane-1,1,4-triol?
The IUPAC name of actinium;butane-1,1,4-triol (CID 22090838) is actinium;butane-1,1,4-triol.
What is the SMILES notation for actinium;butane-1,1,4-triol?
The canonical SMILES for actinium;butane-1,1,4-triol is OCCCC(O)O.[Ac].
What is the InChIKey of actinium;butane-1,1,4-triol?
The InChIKey is QPPZTRPEBZIAGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3.Ac/c5-3-1-2-4(6)7;/h4-7H,1-3H2;.
What are the key properties of actinium;butane-1,1,4-triol?
actinium;butane-1,1,4-triol has a molecular weight of 333.12 g/mol, XLogP of -0.93, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;butane-1,1,4-triol is sourced from PubChem (CID 22090838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).