C15H21N5OS — CID 22090955
N-[4-[4-(3,5-dimethylthiophen-2-yl)butan-2-ylamino]-6-methyl-1,3,5-triazin-2-yl]formamide (PubChem CID 22090955) has the molecular formula C15H21N5OS and a molecular weight of 319.43 g/mol. Its IUPAC name is N-[4-[4-(3,5-dimethylthiophen-2-yl)butan-2-ylamino]-6-methyl-1,3,5-triazin-2-yl]formamide.
| Compound Name | N-[4-[4-(3,5-dimethylthiophen-2-yl)butan-2-ylamino]-6-methyl-1,3,5-triazin-2-yl]formamide |
|---|---|
| PubChem CID | 22090955 |
| Molecular Formula | C15H21N5OS |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | N-[4-[4-(3,5-dimethylthiophen-2-yl)butan-2-ylamino]-6-methyl-1,3,5-triazin-2-yl]formamide |
| SMILES | Cc1nc(NC=O)nc(NC(C)CCc2sc(C)cc2C)n1 |
| InChI | InChI=1S/C15H21N5OS/c1-9-7-11(3)22-13(9)6-5-10(2)17-15-19-12(4)18-14(20-15)16-8-21/h7-8,10H,5-6H2,1-4H3,(H2,16,17,18,19,20,21) |
| InChIKey | VUQGDIDWWQVHRD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|