About 2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenol
2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenol (PubChem CID 22091946) has the molecular formula C14H12O5S2
and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenol.
Molecular Properties
| Compound Name | 2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenol |
| PubChem CID | 22091946 |
| Molecular Formula | C14H12O5S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenol |
| SMILES | O=S1(=O)CC(S(=O)(=O)c2ccccc2O)c2ccccc21 |
| InChI | InChI=1S/C14H12O5S2/c15-11-6-2-4-8-13(11)21(18,19)14-9-20(16,17)12-7-3-1-5-10(12)14/h1-8,14-15H,9H2 |
| InChIKey | IWSQGFCKDGBQQF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenol?
The IUPAC name of 2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenol (CID 22091946) is 2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenol.
What is the SMILES notation for 2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenol?
The canonical SMILES for 2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenol is O=S1(=O)CC(S(=O)(=O)c2ccccc2O)c2ccccc21.
What is the InChIKey of 2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenol?
The InChIKey is IWSQGFCKDGBQQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O5S2/c15-11-6-2-4-8-13(11)21(18,19)14-9-20(16,17)12-7-3-1-5-10(12)14/h1-8,14-15H,9H2.
What are the key properties of 2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenol?
2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenol has a molecular weight of 324.38 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenol is sourced from PubChem (CID 22091946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).