About 2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenoxy]ethanamine
2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenoxy]ethanamine (PubChem CID 22091957) has the molecular formula C16H17NO5S2
and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenoxy]ethanamine.
Molecular Properties
| Compound Name | 2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenoxy]ethanamine |
| PubChem CID | 22091957 |
| Molecular Formula | C16H17NO5S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenoxy]ethanamine |
| SMILES | NCCOc1cccc(S(=O)(=O)C2CS(=O)(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C16H17NO5S2/c17-8-9-22-12-4-3-5-13(10-12)24(20,21)16-11-23(18,19)15-7-2-1-6-14(15)16/h1-7,10,16H,8-9,11,17H2 |
| InChIKey | XRBLNCWLSIJQMD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenoxy]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenoxy]ethanamine?
The IUPAC name of 2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenoxy]ethanamine (CID 22091957) is 2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenoxy]ethanamine.
What is the SMILES notation for 2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenoxy]ethanamine?
The canonical SMILES for 2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenoxy]ethanamine is NCCOc1cccc(S(=O)(=O)C2CS(=O)(=O)c3ccccc32)c1.
What is the InChIKey of 2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenoxy]ethanamine?
The InChIKey is XRBLNCWLSIJQMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO5S2/c17-8-9-22-12-4-3-5-13(10-12)24(20,21)16-11-23(18,19)15-7-2-1-6-14(15)16/h1-7,10,16H,8-9,11,17H2.
What are the key properties of 2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenoxy]ethanamine?
2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenoxy]ethanamine has a molecular weight of 367.45 g/mol, XLogP of 1.33, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-3-yl)sulfonyl]phenoxy]ethanamine is sourced from PubChem (CID 22091957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).