C20H22N2O5S2 — CID 22091959
2-[3-[[3-(benzenesulfonyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-4-yl]oxy]propyl-methylamino]acetonitrile (PubChem CID 22091959) has the molecular formula C20H22N2O5S2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[3-[[3-(benzenesulfonyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-4-yl]oxy]propyl-methylamino]acetonitrile.
| Compound Name | 2-[3-[[3-(benzenesulfonyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-4-yl]oxy]propyl-methylamino]acetonitrile |
|---|---|
| PubChem CID | 22091959 |
| Molecular Formula | C20H22N2O5S2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 2-[3-[[3-(benzenesulfonyl)-1,1-dioxo-2,3-dihydro-1-benzothiophen-4-yl]oxy]propyl-methylamino]acetonitrile |
| SMILES | CN(CC#N)CCCOc1cccc2c1C(S(=O)(=O)c1ccccc1)CS2(=O)=O |
| InChI | InChI=1S/C20H22N2O5S2/c1-22(13-11-21)12-6-14-27-17-9-5-10-18-20(17)19(15-28(18,23)24)29(25,26)16-7-3-2-4-8-16/h2-5,7-10,19H,6,12-15H2,1H3 |
| InChIKey | QUYGZOBTLKPDIX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 104.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|