C19H21N3O4S — CID 2209389
1-(4-acetylphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)urea (PubChem CID 2209389) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)urea.
| Compound Name | 1-(4-acetylphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)urea |
|---|---|
| PubChem CID | 2209389 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-(4-acetylphenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)urea |
| SMILES | CC(=O)c1ccc(NC(=O)Nc2ccc(S(=O)(=O)N3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C19H21N3O4S/c1-14(23)15-4-6-16(7-5-15)20-19(24)21-17-8-10-18(11-9-17)27(25,26)22-12-2-3-13-22/h4-11H,2-3,12-13H2,1H3,(H2,20,21,24) |
| InChIKey | HWQGCKJRIPQHJO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |