C19H34N2O2 — CID 22094157
3-methyl-4-(2-methylbutyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione (PubChem CID 22094157) has the molecular formula C19H34N2O2 and a molecular weight of 322.49 g/mol. Its IUPAC name is 3-methyl-4-(2-methylbutyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-methyl-4-(2-methylbutyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 22094157 |
| Molecular Formula | C19H34N2O2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.26 |
| IUPAC Name | 3-methyl-4-(2-methylbutyl)-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione |
| SMILES | CCC(C)CC1C(=O)N(C2CC(C)(C)NC(C)(C)C2)C(=O)C1C |
| InChI | InChI=1S/C19H34N2O2/c1-8-12(2)9-15-13(3)16(22)21(17(15)23)14-10-18(4,5)20-19(6,7)11-14/h12-15,20H,8-11H2,1-7H3 |
| InChIKey | IGKJABLYAMCGLU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|