C36H74N4O4 — CID 22094205
N,N'-dipropoxy-N,N'-bis(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)hexane-1,6-diamine (PubChem CID 22094205) has the molecular formula C36H74N4O4 and a molecular weight of 627.01 g/mol. Its IUPAC name is N,N'-dipropoxy-N,N'-bis(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)hexane-1,6-diamine.
| Compound Name | N,N'-dipropoxy-N,N'-bis(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 22094205 |
| Molecular Formula | C36H74N4O4 |
| Molecular Weight | 627.01 g/mol |
| Exact Mass | 626.57 |
| IUPAC Name | N,N'-dipropoxy-N,N'-bis(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl)hexane-1,6-diamine |
| SMILES | CCCON(CCCCCCN(OCCC)C1CC(C)(C)N(OCCC)C(C)(C)C1)C1CC(C)(C)N(OCCC)C(C)(C)C1 |
| InChI | InChI=1S/C36H74N4O4/c1-13-23-41-37(31-27-33(5,6)39(43-25-15-3)34(7,8)28-31)21-19-17-18-20-22-38(42-24-14-2)32-29-35(9,10)40(44-26-16-4)36(11,12)30-32/h31-32H,13-30H2,1-12H3 |
| InChIKey | YFFBVQUTYFXHLA-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.01 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|