About 2,2-difluoro-1,4-dioxane
2,2-difluoro-1,4-dioxane (PubChem CID 22094288) has the molecular formula C4H6F2O2
and a molecular weight of 124.09 g/mol. Its IUPAC name is 2,2-difluoro-1,4-dioxane.
Molecular Properties
| Compound Name | 2,2-difluoro-1,4-dioxane |
| PubChem CID | 22094288 |
| Molecular Formula | C4H6F2O2 |
| Molecular Weight | 124.09 g/mol |
| Exact Mass | 124.03 |
| IUPAC Name | 2,2-difluoro-1,4-dioxane |
| SMILES | FC1(F)COCCO1 |
| InChI | InChI=1S/C4H6F2O2/c5-4(6)3-7-1-2-8-4/h1-3H2 |
| InChIKey | ZEBAPYWJINOXAA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.09 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-difluoro-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-1,4-dioxane?
The IUPAC name of 2,2-difluoro-1,4-dioxane (CID 22094288) is 2,2-difluoro-1,4-dioxane.
What is the SMILES notation for 2,2-difluoro-1,4-dioxane?
The canonical SMILES for 2,2-difluoro-1,4-dioxane is FC1(F)COCCO1.
What is the InChIKey of 2,2-difluoro-1,4-dioxane?
The InChIKey is ZEBAPYWJINOXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F2O2/c5-4(6)3-7-1-2-8-4/h1-3H2.
What are the key properties of 2,2-difluoro-1,4-dioxane?
2,2-difluoro-1,4-dioxane has a molecular weight of 124.09 g/mol, XLogP of 0.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-1,4-dioxane is sourced from PubChem (CID 22094288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).