About 3,4-dimethyl-1-methylidene-1,3-thiazolidine
3,4-dimethyl-1-methylidene-1,3-thiazolidine (PubChem CID 22094366) has the molecular formula C6H13NS
and a molecular weight of 131.24 g/mol. Its IUPAC name is 3,4-dimethyl-1-methylidene-1,3-thiazolidine.
Molecular Properties
| Compound Name | 3,4-dimethyl-1-methylidene-1,3-thiazolidine |
| PubChem CID | 22094366 |
| Molecular Formula | C6H13NS |
| Molecular Weight | 131.24 g/mol |
| Exact Mass | 131.08 |
| IUPAC Name | 3,4-dimethyl-1-methylidene-1,3-thiazolidine |
| SMILES | C=S1CC(C)N(C)C1 |
| InChI | InChI=1S/C6H13NS/c1-6-4-8(3)5-7(6)2/h6H,3-5H2,1-2H3 |
| InChIKey | PRNTYQBXJQUORK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-1-methylidene-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-1-methylidene-1,3-thiazolidine?
The IUPAC name of 3,4-dimethyl-1-methylidene-1,3-thiazolidine (CID 22094366) is 3,4-dimethyl-1-methylidene-1,3-thiazolidine.
What is the SMILES notation for 3,4-dimethyl-1-methylidene-1,3-thiazolidine?
The canonical SMILES for 3,4-dimethyl-1-methylidene-1,3-thiazolidine is C=S1CC(C)N(C)C1.
What is the InChIKey of 3,4-dimethyl-1-methylidene-1,3-thiazolidine?
The InChIKey is PRNTYQBXJQUORK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NS/c1-6-4-8(3)5-7(6)2/h6H,3-5H2,1-2H3.
What are the key properties of 3,4-dimethyl-1-methylidene-1,3-thiazolidine?
3,4-dimethyl-1-methylidene-1,3-thiazolidine has a molecular weight of 131.24 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-1-methylidene-1,3-thiazolidine is sourced from PubChem (CID 22094366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).