C20H20FNO3 — CID 22094947
3-(3,3-dimethoxypropyl)-3-(4-fluorophenyl)-6-isocyano-1H-2-benzofuran (PubChem CID 22094947) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is 3-(3,3-dimethoxypropyl)-3-(4-fluorophenyl)-6-isocyano-1H-2-benzofuran.
| Compound Name | 3-(3,3-dimethoxypropyl)-3-(4-fluorophenyl)-6-isocyano-1H-2-benzofuran |
|---|---|
| PubChem CID | 22094947 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-(3,3-dimethoxypropyl)-3-(4-fluorophenyl)-6-isocyano-1H-2-benzofuran |
| SMILES | [C-]#[N+]c1ccc2c(c1)COC2(CCC(OC)OC)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FNO3/c1-22-17-8-9-18-14(12-17)13-25-20(18,11-10-19(23-2)24-3)15-4-6-16(21)7-5-15/h4-9,12,19H,10-11,13H2,2-3H3 |
| InChIKey | DYUDWHXQABMMTQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 32.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|