C4HF7O6S3 — CID 22095324
4,4,5,5-tetrafluoro-2-(trifluoromethylsulfonyl)-1,3-dithiolane 1,1,3,3-tetraoxide (PubChem CID 22095324) has the molecular formula C4HF7O6S3 and a molecular weight of 374.23 g/mol. Its IUPAC name is 4,4,5,5-tetrafluoro-2-(trifluoromethylsulfonyl)-1,3-dithiolane 1,1,3,3-tetraoxide.
| Compound Name | 4,4,5,5-tetrafluoro-2-(trifluoromethylsulfonyl)-1,3-dithiolane 1,1,3,3-tetraoxide |
|---|---|
| PubChem CID | 22095324 |
| Molecular Formula | C4HF7O6S3 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.88 |
| IUPAC Name | 4,4,5,5-tetrafluoro-2-(trifluoromethylsulfonyl)-1,3-dithiolane 1,1,3,3-tetraoxide |
| SMILES | O=S(=O)(C1S(=O)(=O)C(F)(F)C(F)(F)S1(=O)=O)C(F)(F)F |
| InChI | InChI=1S/C4HF7O6S3/c5-2(6)3(7,8)19(14,15)1(18(2,12)13)20(16,17)4(9,10)11/h1H |
| InChIKey | OBHRPNCAIANRPJ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|