C17H19Cl2NO5S — CID 22095929
N-(3,5-dichloro-4-hydroxy-2,6-dimethoxyphenyl)-2,4,5-trimethylbenzenesulfonamide (PubChem CID 22095929) has the molecular formula C17H19Cl2NO5S and a molecular weight of 420.31 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxy-2,6-dimethoxyphenyl)-2,4,5-trimethylbenzenesulfonamide.
| Compound Name | N-(3,5-dichloro-4-hydroxy-2,6-dimethoxyphenyl)-2,4,5-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22095929 |
| Molecular Formula | C17H19Cl2NO5S |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxy-2,6-dimethoxyphenyl)-2,4,5-trimethylbenzenesulfonamide |
| SMILES | COc1c(Cl)c(O)c(Cl)c(OC)c1NS(=O)(=O)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C17H19Cl2NO5S/c1-8-6-10(3)11(7-9(8)2)26(22,23)20-14-16(24-4)12(18)15(21)13(19)17(14)25-5/h6-7,20-21H,1-5H3 |
| InChIKey | ABKRGOKMRUVQNO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|