C6H4O3 — CID 22096055
2-(hydroxymethylidene)cyclopent-4-ene-1,3-dione (PubChem CID 22096055) has the molecular formula C6H4O3 and a molecular weight of 124.09 g/mol. Its IUPAC name is 2-(hydroxymethylidene)cyclopent-4-ene-1,3-dione.
| Compound Name | 2-(hydroxymethylidene)cyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 22096055 |
| Molecular Formula | C6H4O3 |
| Molecular Weight | 124.09 g/mol |
| Exact Mass | 124.02 |
| IUPAC Name | 2-(hydroxymethylidene)cyclopent-4-ene-1,3-dione |
| SMILES | O=C1C=CC(=O)C1=CO |
| InChI | InChI=1S/C6H4O3/c7-3-4-5(8)1-2-6(4)9/h1-3,7H |
| InChIKey | MVZQTMVDCLUWDG-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.09 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|