About 6,7-dichloro-5-(ethylsulfonylmethyl)-2,3-dimethoxyquinoxaline
6,7-dichloro-5-(ethylsulfonylmethyl)-2,3-dimethoxyquinoxaline (PubChem CID 22097012) has the molecular formula C13H14Cl2N2O4S
and a molecular weight of 365.24 g/mol. Its IUPAC name is 6,7-dichloro-5-(ethylsulfonylmethyl)-2,3-dimethoxyquinoxaline.
Molecular Properties
| Compound Name | 6,7-dichloro-5-(ethylsulfonylmethyl)-2,3-dimethoxyquinoxaline |
| PubChem CID | 22097012 |
| Molecular Formula | C13H14Cl2N2O4S |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 6,7-dichloro-5-(ethylsulfonylmethyl)-2,3-dimethoxyquinoxaline |
| SMILES | CCS(=O)(=O)Cc1c(Cl)c(Cl)cc2nc(OC)c(OC)nc12 |
| InChI | InChI=1S/C13H14Cl2N2O4S/c1-4-22(18,19)6-7-10(15)8(14)5-9-11(7)17-13(21-3)12(16-9)20-2/h5H,4,6H2,1-3H3 |
| InChIKey | ZCBWODICBISKBX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6,7-dichloro-5-(ethylsulfonylmethyl)-2,3-dimethoxyquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dichloro-5-(ethylsulfonylmethyl)-2,3-dimethoxyquinoxaline?
The IUPAC name of 6,7-dichloro-5-(ethylsulfonylmethyl)-2,3-dimethoxyquinoxaline (CID 22097012) is 6,7-dichloro-5-(ethylsulfonylmethyl)-2,3-dimethoxyquinoxaline.
What is the SMILES notation for 6,7-dichloro-5-(ethylsulfonylmethyl)-2,3-dimethoxyquinoxaline?
The canonical SMILES for 6,7-dichloro-5-(ethylsulfonylmethyl)-2,3-dimethoxyquinoxaline is CCS(=O)(=O)Cc1c(Cl)c(Cl)cc2nc(OC)c(OC)nc12.
What is the InChIKey of 6,7-dichloro-5-(ethylsulfonylmethyl)-2,3-dimethoxyquinoxaline?
The InChIKey is ZCBWODICBISKBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2N2O4S/c1-4-22(18,19)6-7-10(15)8(14)5-9-11(7)17-13(21-3)12(16-9)20-2/h5H,4,6H2,1-3H3.
What are the key properties of 6,7-dichloro-5-(ethylsulfonylmethyl)-2,3-dimethoxyquinoxaline?
6,7-dichloro-5-(ethylsulfonylmethyl)-2,3-dimethoxyquinoxaline has a molecular weight of 365.24 g/mol, XLogP of 2.89, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dichloro-5-(ethylsulfonylmethyl)-2,3-dimethoxyquinoxaline is sourced from PubChem (CID 22097012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).