C15H10F3N3O4 — CID 22097211
methyl 1-[2,3-dioxo-7-(trifluoromethyl)-1,4-dihydroquinoxalin-6-yl]pyrrole-2-carboxylate (PubChem CID 22097211) has the molecular formula C15H10F3N3O4 and a molecular weight of 353.26 g/mol. Its IUPAC name is methyl 1-[2,3-dioxo-7-(trifluoromethyl)-1,4-dihydroquinoxalin-6-yl]pyrrole-2-carboxylate.
| Compound Name | methyl 1-[2,3-dioxo-7-(trifluoromethyl)-1,4-dihydroquinoxalin-6-yl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 22097211 |
| Molecular Formula | C15H10F3N3O4 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | methyl 1-[2,3-dioxo-7-(trifluoromethyl)-1,4-dihydroquinoxalin-6-yl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cccn1-c1cc2[nH]c(=O)c(=O)[nH]c2cc1C(F)(F)F |
| InChI | InChI=1S/C15H10F3N3O4/c1-25-14(24)10-3-2-4-21(10)11-6-9-8(5-7(11)15(16,17)18)19-12(22)13(23)20-9/h2-6H,1H3,(H,19,22)(H,20,23) |
| InChIKey | GMONASUDUSDTLN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|