About methyl 1-[4-cyclohexyl-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-2-carboxylate
methyl 1-[4-cyclohexyl-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-2-carboxylate (PubChem CID 22097228) has the molecular formula C21H20F3N3O4
and a molecular weight of 435.40 g/mol. Its IUPAC name is methyl 1-[4-cyclohexyl-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[4-cyclohexyl-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-2-carboxylate |
| PubChem CID | 22097228 |
| Molecular Formula | C21H20F3N3O4 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | methyl 1-[4-cyclohexyl-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-2-carboxylate |
| SMILES | COC(=O)c1cccn1-c1cc2c(cc1C(F)(F)F)[nH]c(=O)c(=O)n2C1CCCCC1 |
| InChI | InChI=1S/C21H20F3N3O4/c1-31-20(30)15-8-5-9-26(15)16-11-17-14(10-13(16)21(22,23)24)25-18(28)19(29)27(17)12-6-3-2-4-7-12/h5,8-12H,2-4,6-7H2,1H3,(H,25,28) |
| InChIKey | XEABHXZGNINVSD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[4-cyclohexyl-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[4-cyclohexyl-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-2-carboxylate?
The IUPAC name of methyl 1-[4-cyclohexyl-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-2-carboxylate (CID 22097228) is methyl 1-[4-cyclohexyl-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-2-carboxylate.
What is the SMILES notation for methyl 1-[4-cyclohexyl-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-2-carboxylate?
The canonical SMILES for methyl 1-[4-cyclohexyl-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-2-carboxylate is COC(=O)c1cccn1-c1cc2c(cc1C(F)(F)F)[nH]c(=O)c(=O)n2C1CCCCC1.
What is the InChIKey of methyl 1-[4-cyclohexyl-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-2-carboxylate?
The InChIKey is XEABHXZGNINVSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F3N3O4/c1-31-20(30)15-8-5-9-26(15)16-11-17-14(10-13(16)21(22,23)24)25-18(28)19(29)27(17)12-6-3-2-4-7-12/h5,8-12H,2-4,6-7H2,1H3,(H,25,28).
What are the key properties of methyl 1-[4-cyclohexyl-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-2-carboxylate?
methyl 1-[4-cyclohexyl-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-2-carboxylate has a molecular weight of 435.40 g/mol, XLogP of 3.79, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[4-cyclohexyl-2,3-dioxo-7-(trifluoromethyl)-1H-quinoxalin-6-yl]pyrrole-2-carboxylate is sourced from PubChem (CID 22097228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).