C10H17N3O2 — CID 22097487
3-ethyl-8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 22097487) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-ethyl-8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-ethyl-8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 22097487 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3-ethyl-8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCN1C(=O)NC2(CCN(C)CC2)C1=O |
| InChI | InChI=1S/C10H17N3O2/c1-3-13-8(14)10(11-9(13)15)4-6-12(2)7-5-10/h3-7H2,1-2H3,(H,11,15) |
| InChIKey | FHFJNCYHQZPOSL-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|