C28H31N3O6 — CID 22097656
butyl 4-(3,4-dimethoxyphenyl)-2-(imidazol-1-ylmethyl)-6,7-dimethoxyquinoline-3-carboxylate (PubChem CID 22097656) has the molecular formula C28H31N3O6 and a molecular weight of 505.57 g/mol. Its IUPAC name is butyl 4-(3,4-dimethoxyphenyl)-2-(imidazol-1-ylmethyl)-6,7-dimethoxyquinoline-3-carboxylate.
| Compound Name | butyl 4-(3,4-dimethoxyphenyl)-2-(imidazol-1-ylmethyl)-6,7-dimethoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 22097656 |
| Molecular Formula | C28H31N3O6 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | butyl 4-(3,4-dimethoxyphenyl)-2-(imidazol-1-ylmethyl)-6,7-dimethoxyquinoline-3-carboxylate |
| SMILES | CCCCOC(=O)c1c(Cn2ccnc2)nc2cc(OC)c(OC)cc2c1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C28H31N3O6/c1-6-7-12-37-28(32)27-21(16-31-11-10-29-17-31)30-20-15-25(36-5)24(35-4)14-19(20)26(27)18-8-9-22(33-2)23(13-18)34-3/h8-11,13-15,17H,6-7,12,16H2,1-5H3 |
| InChIKey | NJUOXUSRLWFARF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 93.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|