C18H6F5NO4S — CID 22098072
2-(2,3,4,5,6-pentafluorophenyl)sulfonylbenzo[e]isoindole-1,3-dione (PubChem CID 22098072) has the molecular formula C18H6F5NO4S and a molecular weight of 427.31 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)sulfonylbenzo[e]isoindole-1,3-dione.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)sulfonylbenzo[e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 22098072 |
| Molecular Formula | C18H6F5NO4S |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)sulfonylbenzo[e]isoindole-1,3-dione |
| SMILES | O=C1c2ccc3ccccc3c2C(=O)N1S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H6F5NO4S/c19-11-12(20)14(22)16(15(23)13(11)21)29(27,28)24-17(25)9-6-5-7-3-1-2-4-8(7)10(9)18(24)26/h1-6H |
| InChIKey | LWSXXJQMJQHTAK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|