About trihexyl 4-(oxiran-2-yl)butyl silicate
trihexyl 4-(oxiran-2-yl)butyl silicate (PubChem CID 22098092) has the molecular formula C24H50O5Si
and a molecular weight of 446.75 g/mol. Its IUPAC name is trihexyl 4-(oxiran-2-yl)butyl silicate.
Molecular Properties
| Compound Name | trihexyl 4-(oxiran-2-yl)butyl silicate |
| PubChem CID | 22098092 |
| Molecular Formula | C24H50O5Si |
| Molecular Weight | 446.75 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | trihexyl 4-(oxiran-2-yl)butyl silicate |
| SMILES | CCCCCCO[Si](OCCCCCC)(OCCCCCC)OCCCCC1CO1 |
| InChI | InChI=1S/C24H50O5Si/c1-4-7-10-14-19-26-30(27-20-15-11-8-5-2,28-21-16-12-9-6-3)29-22-17-13-18-24-23-25-24/h24H,4-23H2,1-3H3 |
| InChIKey | ZVQVELKKDPCQGT-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.75 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze trihexyl 4-(oxiran-2-yl)butyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trihexyl 4-(oxiran-2-yl)butyl silicate?
The IUPAC name of trihexyl 4-(oxiran-2-yl)butyl silicate (CID 22098092) is trihexyl 4-(oxiran-2-yl)butyl silicate.
What is the SMILES notation for trihexyl 4-(oxiran-2-yl)butyl silicate?
The canonical SMILES for trihexyl 4-(oxiran-2-yl)butyl silicate is CCCCCCO[Si](OCCCCCC)(OCCCCCC)OCCCCC1CO1.
What is the InChIKey of trihexyl 4-(oxiran-2-yl)butyl silicate?
The InChIKey is ZVQVELKKDPCQGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H50O5Si/c1-4-7-10-14-19-26-30(27-20-15-11-8-5-2,28-21-16-12-9-6-3)29-22-17-13-18-24-23-25-24/h24H,4-23H2,1-3H3.
What are the key properties of trihexyl 4-(oxiran-2-yl)butyl silicate?
trihexyl 4-(oxiran-2-yl)butyl silicate has a molecular weight of 446.75 g/mol, XLogP of 6.80, 24 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trihexyl 4-(oxiran-2-yl)butyl silicate is sourced from PubChem (CID 22098092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).