C20H34O5Si5 — CID 22098134
(2,4-dimethyl-6,6-diphenyl-4-trimethylsilyloxy-1,3,5,2,4,6-trioxatrisilinan-2-yl)oxy-trimethylsilane (PubChem CID 22098134) has the molecular formula C20H34O5Si5 and a molecular weight of 494.92 g/mol. Its IUPAC name is (2,4-dimethyl-6,6-diphenyl-4-trimethylsilyloxy-1,3,5,2,4,6-trioxatrisilinan-2-yl)oxy-trimethylsilane.
| Compound Name | (2,4-dimethyl-6,6-diphenyl-4-trimethylsilyloxy-1,3,5,2,4,6-trioxatrisilinan-2-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 22098134 |
| Molecular Formula | C20H34O5Si5 |
| Molecular Weight | 494.92 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | (2,4-dimethyl-6,6-diphenyl-4-trimethylsilyloxy-1,3,5,2,4,6-trioxatrisilinan-2-yl)oxy-trimethylsilane |
| SMILES | C[Si](C)(C)O[Si]1(C)O[Si](C)(O[Si](C)(C)C)O[Si](c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C20H34O5Si5/c1-26(2,3)21-28(7)23-29(8,22-27(4,5)6)25-30(24-28,19-15-11-9-12-16-19)20-17-13-10-14-18-20/h9-18H,1-8H3 |
| InChIKey | WUAARQDXHKBTGR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.92 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|