C21H20N4O5 — CID 22098975
2-[(E)-2-carboxyethenyl]-5-[[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzoyl]amino]benzoic acid (PubChem CID 22098975) has the molecular formula C21H20N4O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is 2-[(E)-2-carboxyethenyl]-5-[[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzoyl]amino]benzoic acid.
| Compound Name | 2-[(E)-2-carboxyethenyl]-5-[[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 22098975 |
| Molecular Formula | C21H20N4O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 2-[(E)-2-carboxyethenyl]-5-[[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzoyl]amino]benzoic acid |
| SMILES | O=C(O)/C=C/c1ccc(NC(=O)c2cccc(NC3=NCCCN3)c2)cc1C(=O)O |
| InChI | InChI=1S/C21H20N4O5/c26-18(27)8-6-13-5-7-16(12-17(13)20(29)30)24-19(28)14-3-1-4-15(11-14)25-21-22-9-2-10-23-21/h1,3-8,11-12H,2,9-10H2,(H,24,28)(H,26,27)(H,29,30)(H2,22,23,25)/b8-6+ |
| InChIKey | MSJFRVFQMDZEFH-SOFGYWHQSA-N |
| XLogP | 2.50 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|