About methyl 5-methyl-1,3,4-thiadiazole-2-carboxylate
methyl 5-methyl-1,3,4-thiadiazole-2-carboxylate (PubChem CID 22099273) has the molecular formula C5H6N2O2S
and a molecular weight of 158.18 g/mol. Its IUPAC name is methyl 5-methyl-1,3,4-thiadiazole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-methyl-1,3,4-thiadiazole-2-carboxylate |
| PubChem CID | 22099273 |
| Molecular Formula | C5H6N2O2S |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | methyl 5-methyl-1,3,4-thiadiazole-2-carboxylate |
| SMILES | COC(=O)c1nnc(C)s1 |
| InChI | InChI=1S/C5H6N2O2S/c1-3-6-7-4(10-3)5(8)9-2/h1-2H3 |
| InChIKey | FTFRZFCLWBOJIJ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-methyl-1,3,4-thiadiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methyl-1,3,4-thiadiazole-2-carboxylate?
The IUPAC name of methyl 5-methyl-1,3,4-thiadiazole-2-carboxylate (CID 22099273) is methyl 5-methyl-1,3,4-thiadiazole-2-carboxylate.
What is the SMILES notation for methyl 5-methyl-1,3,4-thiadiazole-2-carboxylate?
The canonical SMILES for methyl 5-methyl-1,3,4-thiadiazole-2-carboxylate is COC(=O)c1nnc(C)s1.
What is the InChIKey of methyl 5-methyl-1,3,4-thiadiazole-2-carboxylate?
The InChIKey is FTFRZFCLWBOJIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2S/c1-3-6-7-4(10-3)5(8)9-2/h1-2H3.
What are the key properties of methyl 5-methyl-1,3,4-thiadiazole-2-carboxylate?
methyl 5-methyl-1,3,4-thiadiazole-2-carboxylate has a molecular weight of 158.18 g/mol, XLogP of 0.63, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methyl-1,3,4-thiadiazole-2-carboxylate is sourced from PubChem (CID 22099273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).