About 3-methyl-1,2,4-thiadiazole-5-carbonitrile
3-methyl-1,2,4-thiadiazole-5-carbonitrile (PubChem CID 22099279) has the molecular formula C4H3N3S
and a molecular weight of 125.16 g/mol. Its IUPAC name is 3-methyl-1,2,4-thiadiazole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-methyl-1,2,4-thiadiazole-5-carbonitrile |
| PubChem CID | 22099279 |
| Molecular Formula | C4H3N3S |
| Molecular Weight | 125.16 g/mol |
| Exact Mass | 125.00 |
| IUPAC Name | 3-methyl-1,2,4-thiadiazole-5-carbonitrile |
| SMILES | Cc1nsc(C#N)n1 |
| InChI | InChI=1S/C4H3N3S/c1-3-6-4(2-5)8-7-3/h1H3 |
| InChIKey | ZQOFTBZFHUPVOR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.16 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-1,2,4-thiadiazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,2,4-thiadiazole-5-carbonitrile?
The IUPAC name of 3-methyl-1,2,4-thiadiazole-5-carbonitrile (CID 22099279) is 3-methyl-1,2,4-thiadiazole-5-carbonitrile.
What is the SMILES notation for 3-methyl-1,2,4-thiadiazole-5-carbonitrile?
The canonical SMILES for 3-methyl-1,2,4-thiadiazole-5-carbonitrile is Cc1nsc(C#N)n1.
What is the InChIKey of 3-methyl-1,2,4-thiadiazole-5-carbonitrile?
The InChIKey is ZQOFTBZFHUPVOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3N3S/c1-3-6-4(2-5)8-7-3/h1H3.
What are the key properties of 3-methyl-1,2,4-thiadiazole-5-carbonitrile?
3-methyl-1,2,4-thiadiazole-5-carbonitrile has a molecular weight of 125.16 g/mol, XLogP of 0.72, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,2,4-thiadiazole-5-carbonitrile is sourced from PubChem (CID 22099279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).